C29H31ClN6O3 — CID 67534708
N-[2-amino-1-(4-chlorophenyl)-2-oxo-1-phenylethyl]-3-(diaminomethylideneamino)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propanamide (PubChem CID 67534708) has the molecular formula C29H31ClN6O3 and a molecular weight of 547.06 g/mol. Its IUPAC name is N-[2-amino-1-(4-chlorophenyl)-2-oxo-1-phenylethyl]-3-(diaminomethylideneamino)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propanamide.
| Compound Name | N-[2-amino-1-(4-chlorophenyl)-2-oxo-1-phenylethyl]-3-(diaminomethylideneamino)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 67534708 |
| Molecular Formula | C29H31ClN6O3 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[2-amino-1-(4-chlorophenyl)-2-oxo-1-phenylethyl]-3-(diaminomethylideneamino)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propanamide |
| SMILES | COc1ccc2[nH]cc(CCN(C(=O)CCN=C(N)N)C(C(N)=O)(c3ccccc3)c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C29H31ClN6O3/c1-39-23-11-12-25-24(17-23)19(18-35-25)14-16-36(26(37)13-15-34-28(32)33)29(27(31)38,20-5-3-2-4-6-20)21-7-9-22(30)10-8-21/h2-12,17-18,35H,13-16H2,1H3,(H2,31,38)(H4,32,33,34) |
| InChIKey | IRPDVPSEJCQRAS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|