C19H22ClN3O5 — CID 67534990
[3-amino-4-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-4-oxobutyl]carbamic acid (PubChem CID 67534990) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is [3-amino-4-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-4-oxobutyl]carbamic acid.
| Compound Name | [3-amino-4-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-4-oxobutyl]carbamic acid |
|---|---|
| PubChem CID | 67534990 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [3-amino-4-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-4-oxobutyl]carbamic acid |
| SMILES | COc1ccc(Oc2ccc(CNC(=O)C(N)CCNC(=O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O5/c1-27-14-6-7-17(15(20)10-14)28-13-4-2-12(3-5-13)11-23-18(24)16(21)8-9-22-19(25)26/h2-7,10,16,22H,8-9,11,21H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | IUONDWICEGELCX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |