C25H28ClN5O4 — CID 70846518
N-[(2S)-6-amino-1-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-1-oxohexan-2-yl]pyrimidine-5-carboxamide (PubChem CID 70846518) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-1-oxohexan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-[(2S)-6-amino-1-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-1-oxohexan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70846518 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[(2S)-6-amino-1-[[4-(2-chloro-4-methoxyphenoxy)phenyl]methylamino]-1-oxohexan-2-yl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Oc2ccc(CNC(=O)[C@H](CCCCN)NC(=O)c3cncnc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H28ClN5O4/c1-34-20-9-10-23(21(26)12-20)35-19-7-5-17(6-8-19)13-30-25(33)22(4-2-3-11-27)31-24(32)18-14-28-16-29-15-18/h5-10,12,14-16,22H,2-4,11,13,27H2,1H3,(H,30,33)(H,31,32)/t22-/m0/s1 |
| InChIKey | SMASCVIEVXVCDF-QFIPXVFZSA-N |
| XLogP | 3.47 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|