C28H36ClN3O6 — CID 70846596
[(E)-but-2-en-2-yl] N-[(2S)-6-acetamido-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 70846596) has the molecular formula C28H36ClN3O6 and a molecular weight of 546.06 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl] N-[(2S)-6-acetamido-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | [(E)-but-2-en-2-yl] N-[(2S)-6-acetamido-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 70846596 |
| Molecular Formula | C28H36ClN3O6 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | [(E)-but-2-en-2-yl] N-[(2S)-6-acetamido-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | C/C=C(\C)OC(=O)N[C@@H](CCCCNC(C)=O)C(=O)NCc1ccc(Oc2ccc(C(C)O)cc2Cl)cc1 |
| InChI | InChI=1S/C28H36ClN3O6/c1-5-18(2)37-28(36)32-25(8-6-7-15-30-20(4)34)27(35)31-17-21-9-12-23(13-10-21)38-26-14-11-22(19(3)33)16-24(26)29/h5,9-14,16,19,25,33H,6-8,15,17H2,1-4H3,(H,30,34)(H,31,35)(H,32,36)/b18-5+/t19?,25-/m0/s1 |
| InChIKey | AJWNGWHGQWTSRR-KOOUXFDVSA-N |
| XLogP | 5.13 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|