C31H35ClN2O6 — CID 70846537
[(E)-but-2-en-2-yl] N-[(2S)-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate (PubChem CID 70846537) has the molecular formula C31H35ClN2O6 and a molecular weight of 567.08 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl] N-[(2S)-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | [(E)-but-2-en-2-yl] N-[(2S)-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70846537 |
| Molecular Formula | C31H35ClN2O6 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [(E)-but-2-en-2-yl] N-[(2S)-1-[[4-[2-chloro-4-(1-hydroxyethyl)phenoxy]phenyl]methylamino]-1-oxo-4-phenylmethoxybutan-2-yl]carbamate |
| SMILES | C/C=C(\C)OC(=O)N[C@@H](CCOCc1ccccc1)C(=O)NCc1ccc(Oc2ccc(C(C)O)cc2Cl)cc1 |
| InChI | InChI=1S/C31H35ClN2O6/c1-4-21(2)39-31(37)34-28(16-17-38-20-24-8-6-5-7-9-24)30(36)33-19-23-10-13-26(14-11-23)40-29-15-12-25(22(3)35)18-27(29)32/h4-15,18,22,28,35H,16-17,19-20H2,1-3H3,(H,33,36)(H,34,37)/b21-4+/t22?,28-/m0/s1 |
| InChIKey | ZYLZNZGEGVINEA-OAVYLXJRSA-N |
| XLogP | 6.43 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|