C18H18N4O4Si — CID 67535151
5-[6-[cyano(trimethylsilyloxy)methyl]pyrimidin-4-yl]oxyindole-1-carboxylic acid (PubChem CID 67535151) has the molecular formula C18H18N4O4Si and a molecular weight of 382.45 g/mol. Its IUPAC name is 5-[6-[cyano(trimethylsilyloxy)methyl]pyrimidin-4-yl]oxyindole-1-carboxylic acid.
| Compound Name | 5-[6-[cyano(trimethylsilyloxy)methyl]pyrimidin-4-yl]oxyindole-1-carboxylic acid |
|---|---|
| PubChem CID | 67535151 |
| Molecular Formula | C18H18N4O4Si |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-[6-[cyano(trimethylsilyloxy)methyl]pyrimidin-4-yl]oxyindole-1-carboxylic acid |
| SMILES | C[Si](C)(C)OC(C#N)c1cc(Oc2ccc3c(ccn3C(=O)O)c2)ncn1 |
| InChI | InChI=1S/C18H18N4O4Si/c1-27(2,3)26-16(10-19)14-9-17(21-11-20-14)25-13-4-5-15-12(8-13)6-7-22(15)18(23)24/h4-9,11,16H,1-3H3,(H,23,24) |
| InChIKey | KQBIIVDXERYURT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|