C21H17N5O4 — CID 69316750
[6-[1-(methylcarbamoyl)indol-5-yl]oxypyrimidin-4-yl]-phenylcarbamic acid (PubChem CID 69316750) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is [6-[1-(methylcarbamoyl)indol-5-yl]oxypyrimidin-4-yl]-phenylcarbamic acid.
| Compound Name | [6-[1-(methylcarbamoyl)indol-5-yl]oxypyrimidin-4-yl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 69316750 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [6-[1-(methylcarbamoyl)indol-5-yl]oxypyrimidin-4-yl]-phenylcarbamic acid |
| SMILES | CNC(=O)n1ccc2cc(Oc3cc(N(C(=O)O)c4ccccc4)ncn3)ccc21 |
| InChI | InChI=1S/C21H17N5O4/c1-22-20(27)25-10-9-14-11-16(7-8-17(14)25)30-19-12-18(23-13-24-19)26(21(28)29)15-5-3-2-4-6-15/h2-13H,1H3,(H,22,27)(H,28,29) |
| InChIKey | KAXGODHEFOLYPM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |