C33H37FN4O5S — CID 67540163
[2-fluoro-4-[3-[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]quinoxalin-5-yl]phenyl]-thiomorpholin-4-ylmethanediol (PubChem CID 67540163) has the molecular formula C33H37FN4O5S and a molecular weight of 620.75 g/mol. Its IUPAC name is [2-fluoro-4-[3-[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]quinoxalin-5-yl]phenyl]-thiomorpholin-4-ylmethanediol.
| Compound Name | [2-fluoro-4-[3-[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]quinoxalin-5-yl]phenyl]-thiomorpholin-4-ylmethanediol |
|---|---|
| PubChem CID | 67540163 |
| Molecular Formula | C33H37FN4O5S |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [2-fluoro-4-[3-[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]quinoxalin-5-yl]phenyl]-thiomorpholin-4-ylmethanediol |
| SMILES | COc1cc(-c2cnc3cccc(-c4ccc(C(O)(O)N5CCSCC5)c(F)c4)c3n2)ccc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H37FN4O5S/c1-41-31-21-24(7-9-30(31)43-15-3-10-37-11-16-42-17-12-37)29-22-35-28-5-2-4-25(32(28)36-29)23-6-8-26(27(34)20-23)33(39,40)38-13-18-44-19-14-38/h2,4-9,20-22,39-40H,3,10-19H2,1H3 |
| InChIKey | GKBNUPRXRSAHPH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|