C15H14F3N3O2 — CID 67543512
methyl 4-[[6-(aminomethyl)-3-pyridinyl]amino]-3-(trifluoromethyl)benzoate (PubChem CID 67543512) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is methyl 4-[[6-(aminomethyl)-3-pyridinyl]amino]-3-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[[6-(aminomethyl)-3-pyridinyl]amino]-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 67543512 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | methyl 4-[[6-(aminomethyl)-3-pyridinyl]amino]-3-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc(CN)nc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-23-14(22)9-2-5-13(12(6-9)15(16,17)18)21-11-4-3-10(7-19)20-8-11/h2-6,8,21H,7,19H2,1H3 |
| InChIKey | BDRBINLOLDZWMN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |