C27H29NO3 — CID 67544140
(3,5-dimethylphenyl) (E)-N-(3,4-dimethylphenyl)-3-(4-methoxyphenoxy)-2-methylprop-2-enimidate (PubChem CID 67544140) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (3,5-dimethylphenyl) (E)-N-(3,4-dimethylphenyl)-3-(4-methoxyphenoxy)-2-methylprop-2-enimidate.
| Compound Name | (3,5-dimethylphenyl) (E)-N-(3,4-dimethylphenyl)-3-(4-methoxyphenoxy)-2-methylprop-2-enimidate |
|---|---|
| PubChem CID | 67544140 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3,5-dimethylphenyl) (E)-N-(3,4-dimethylphenyl)-3-(4-methoxyphenoxy)-2-methylprop-2-enimidate |
| SMILES | COc1ccc(O/C=C(C)/C(=N/c2ccc(C)c(C)c2)Oc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-18-13-19(2)15-26(14-18)31-27(28-23-8-7-20(3)21(4)16-23)22(5)17-30-25-11-9-24(29-6)10-12-25/h7-17H,1-6H3/b22-17+,28-27- |
| InChIKey | CIXSVVGWBCDOOR-IKLQQHFESA-N |
| XLogP | 7.02 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|