C26H34N6O4 — CID 67544859
4-[(4-butylphenyl)carbamoylamino]-2-[[5-(pentylcarbamoyl)furan-2-yl]methyl]-1H-imidazole-5-carboxamide (PubChem CID 67544859) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-[(4-butylphenyl)carbamoylamino]-2-[[5-(pentylcarbamoyl)furan-2-yl]methyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-[(4-butylphenyl)carbamoylamino]-2-[[5-(pentylcarbamoyl)furan-2-yl]methyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 67544859 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-[(4-butylphenyl)carbamoylamino]-2-[[5-(pentylcarbamoyl)furan-2-yl]methyl]-1H-imidazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(Cc2nc(NC(=O)Nc3ccc(CCCC)cc3)c(C(N)=O)[nH]2)o1 |
| InChI | InChI=1S/C26H34N6O4/c1-3-5-7-15-28-25(34)20-14-13-19(36-20)16-21-30-22(23(27)33)24(31-21)32-26(35)29-18-11-9-17(10-12-18)8-6-4-2/h9-14H,3-8,15-16H2,1-2H3,(H2,27,33)(H,28,34)(H,30,31)(H2,29,32,35) |
| InChIKey | NJSJEAXUBUONQM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|