About methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride
methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride (PubChem CID 67547916) has the molecular formula C18H22ClN5O4
and a molecular weight of 407.86 g/mol. Its IUPAC name is methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride |
| PubChem CID | 67547916 |
| Molecular Formula | C18H22ClN5O4 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CN(C(=O)CNC(=O)c2cc(-c3ccccc3)n[nH]2)CCN1.Cl |
| InChI | InChI=1S/C18H21N5O4.ClH/c1-27-18(26)15-11-23(8-7-19-15)16(24)10-20-17(25)14-9-13(21-22-14)12-5-3-2-4-6-12;/h2-6,9,15,19H,7-8,10-11H2,1H3,(H,20,25)(H,21,22);1H |
| InChIKey | FOLIVGJQGSPAFF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride (CID 67547916) is methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride is COC(=O)C1CN(C(=O)CNC(=O)c2cc(-c3ccccc3)n[nH]2)CCN1.Cl.
What is the InChIKey of methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride?
The InChIKey is FOLIVGJQGSPAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O4.ClH/c1-27-18(26)15-11-23(8-7-19-15)16(24)10-20-17(25)14-9-13(21-22-14)12-5-3-2-4-6-12;/h2-6,9,15,19H,7-8,10-11H2,1H3,(H,20,25)(H,21,22);1H.
What are the key properties of methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride?
methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride has a molecular weight of 407.86 g/mol, XLogP of 0.20, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]acetyl]piperazine-2-carboxylate;hydrochloride is sourced from PubChem (CID 67547916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).