C12H21NO5 — CID 67549181
3-[(E)-but-2-enoxy]-4,4-dimethoxypiperidine-1-carboxylic acid (PubChem CID 67549181) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-[(E)-but-2-enoxy]-4,4-dimethoxypiperidine-1-carboxylic acid.
| Compound Name | 3-[(E)-but-2-enoxy]-4,4-dimethoxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67549181 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(E)-but-2-enoxy]-4,4-dimethoxypiperidine-1-carboxylic acid |
| SMILES | C/C=C/COC1CN(C(=O)O)CCC1(OC)OC |
| InChI | InChI=1S/C12H21NO5/c1-4-5-8-18-10-9-13(11(14)15)7-6-12(10,16-2)17-3/h4-5,10H,6-9H2,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | BVQNYVBVPKTSPP-SNAWJCMRSA-N |
| XLogP | 1.32 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|