C20H16F2O4 — CID 67549197
1-[4-(difluoromethoxy)phenyl]-2-[2-(4-methoxybut-1-ynyl)phenyl]ethane-1,2-dione (PubChem CID 67549197) has the molecular formula C20H16F2O4 and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[2-(4-methoxybut-1-ynyl)phenyl]ethane-1,2-dione.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[2-(4-methoxybut-1-ynyl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67549197 |
| Molecular Formula | C20H16F2O4 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[2-(4-methoxybut-1-ynyl)phenyl]ethane-1,2-dione |
| SMILES | COCCC#Cc1ccccc1C(=O)C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H16F2O4/c1-25-13-5-4-7-14-6-2-3-8-17(14)19(24)18(23)15-9-11-16(12-10-15)26-20(21)22/h2-3,6,8-12,20H,5,13H2,1H3 |
| InChIKey | FFZSDAIHWYPWFJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|