C18H21N3O3 — CID 67552253
benzyl N-[(2S)-2-(2-amino-4-methylanilino)propanoyl]carbamate (PubChem CID 67552253) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is benzyl N-[(2S)-2-(2-amino-4-methylanilino)propanoyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-(2-amino-4-methylanilino)propanoyl]carbamate |
|---|---|
| PubChem CID | 67552253 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | benzyl N-[(2S)-2-(2-amino-4-methylanilino)propanoyl]carbamate |
| SMILES | Cc1ccc(N[C@@H](C)C(=O)NC(=O)OCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-8-9-16(15(19)10-12)20-13(2)17(22)21-18(23)24-11-14-6-4-3-5-7-14/h3-10,13,20H,11,19H2,1-2H3,(H,21,22,23)/t13-/m0/s1 |
| InChIKey | VMNCWUZIENCXQS-ZDUSSCGKSA-N |
| XLogP | 2.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|