C21H25N5S — CID 67558468
6-methyl-N-(4-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 67558468) has the molecular formula C21H25N5S and a molecular weight of 379.53 g/mol. Its IUPAC name is 6-methyl-N-(4-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(4-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67558468 |
| Molecular Formula | C21H25N5S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 6-methyl-N-(4-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2cc(C)nc(N3CCN(Cc4ccsc4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H25N5S/c1-16-3-5-19(6-4-16)23-20-13-17(2)22-21(24-20)26-10-8-25(9-11-26)14-18-7-12-27-15-18/h3-7,12-13,15H,8-11,14H2,1-2H3,(H,22,23,24) |
| InChIKey | YXUVGZGGUWXWIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |