C17H21ClN2O3S — CID 67565270
methyl (2S)-4-amino-4-methylsulfanyl-2-(naphthalene-1-carbonylamino)butanoate;hydrochloride (PubChem CID 67565270) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is methyl (2S)-4-amino-4-methylsulfanyl-2-(naphthalene-1-carbonylamino)butanoate;hydrochloride.
| Compound Name | methyl (2S)-4-amino-4-methylsulfanyl-2-(naphthalene-1-carbonylamino)butanoate;hydrochloride |
|---|---|
| PubChem CID | 67565270 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl (2S)-4-amino-4-methylsulfanyl-2-(naphthalene-1-carbonylamino)butanoate;hydrochloride |
| SMILES | COC(=O)[C@H](CC(N)SC)NC(=O)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C17H20N2O3S.ClH/c1-22-17(21)14(10-15(18)23-2)19-16(20)13-9-5-7-11-6-3-4-8-12(11)13;/h3-9,14-15H,10,18H2,1-2H3,(H,19,20);1H/t14-,15?;/m0./s1 |
| InChIKey | VYRUJAIYACNFEH-QDVCFFRGSA-N |
| XLogP | 2.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|