C24H35BN3O5 — CID 67565780
CID 67565780 (PubChem CID 67565780) has the molecular formula C24H35BN3O5 and a molecular weight of 456.37 g/mol.
| Compound Name | CID 67565780 |
|---|---|
| PubChem CID | 67565780 |
| Molecular Formula | C24H35BN3O5 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | — |
| SMILES | CO[B]Nc1cccc(CC(NC(=O)OC(C)(C)C)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C24H35BN3O5/c1-24(2,3)33-23(30)27-21(14-17-8-6-10-19(12-17)28-25-32-5)22(29)16-26-15-18-9-7-11-20(13-18)31-4/h6-13,21-22,26,28-29H,14-16H2,1-5H3,(H,27,30)/t21?,22-/m1/s1 |
| InChIKey | CDEHMQWMANRZHM-FOIFJWKZSA-N |
| XLogP | 2.87 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|