C27H19N3O3 — CID 67566873
6-(4-methoxyanilino)-2,3-diphenylquinoxaline-5,8-dione (PubChem CID 67566873) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 6-(4-methoxyanilino)-2,3-diphenylquinoxaline-5,8-dione.
| Compound Name | 6-(4-methoxyanilino)-2,3-diphenylquinoxaline-5,8-dione |
|---|---|
| PubChem CID | 67566873 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-(4-methoxyanilino)-2,3-diphenylquinoxaline-5,8-dione |
| SMILES | COc1ccc(NC2=CC(=O)c3nc(-c4ccccc4)c(-c4ccccc4)nc3C2=O)cc1 |
| InChI | InChI=1S/C27H19N3O3/c1-33-20-14-12-19(13-15-20)28-21-16-22(31)25-26(27(21)32)30-24(18-10-6-3-7-11-18)23(29-25)17-8-4-2-5-9-17/h2-16,28H,1H3 |
| InChIKey | UKRMNUYXFOINAC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|