C24H45N — CID 67568152
N,N-dimethyl-1-(2,3,4-tripentylcyclopenta-1,3-dien-1-yl)ethanamine (PubChem CID 67568152) has the molecular formula C24H45N and a molecular weight of 347.63 g/mol. Its IUPAC name is N,N-dimethyl-1-(2,3,4-tripentylcyclopenta-1,3-dien-1-yl)ethanamine.
| Compound Name | N,N-dimethyl-1-(2,3,4-tripentylcyclopenta-1,3-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 67568152 |
| Molecular Formula | C24H45N |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 347.36 |
| IUPAC Name | N,N-dimethyl-1-(2,3,4-tripentylcyclopenta-1,3-dien-1-yl)ethanamine |
| SMILES | CCCCCC1=C(CCCCC)C(CCCCC)=C(C(C)N(C)C)C1 |
| InChI | InChI=1S/C24H45N/c1-7-10-13-16-21-19-24(20(4)25(5)6)23(18-15-12-9-3)22(21)17-14-11-8-2/h20H,7-19H2,1-6H3 |
| InChIKey | IOILWRBKUFOCJR-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|