C10H12F3NO2S — CID 67575937
N-(2-ethylphenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 67575937) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-(2-ethylphenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 67575937 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(2-ethylphenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2S/c1-2-8-5-3-4-6-9(8)14-17(15,16)7-10(11,12)13/h3-6,14H,2,7H2,1H3 |
| InChIKey | MKWAQWYOVGYQLT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |