About ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one
ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one (PubChem CID 67581827) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one |
| PubChem CID | 67581827 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one |
| SMILES | CCCC(=O)CC(=O)OCC.CCCC1=NN(c2ccccn2)C(=O)C1 |
| InChI | InChI=1S/C11H13N3O.C8H14O3/c1-2-5-9-8-11(15)14(13-9)10-6-3-4-7-12-10;1-3-5-7(9)6-8(10)11-4-2/h3-4,6-7H,2,5,8H2,1H3;3-6H2,1-2H3 |
| InChIKey | MVQYZQNOKROAOV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one?
The IUPAC name of ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one (CID 67581827) is ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one.
What is the SMILES notation for ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one?
The canonical SMILES for ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one is CCCC(=O)CC(=O)OCC.CCCC1=NN(c2ccccn2)C(=O)C1.
What is the InChIKey of ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one?
The InChIKey is MVQYZQNOKROAOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C8H14O3/c1-2-5-9-8-11(15)14(13-9)10-6-3-4-7-12-10;1-3-5-7(9)6-8(10)11-4-2/h3-4,6-7H,2,5,8H2,1H3;3-6H2,1-2H3.
What are the key properties of ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one?
ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one has a molecular weight of 361.44 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxohexanoate;5-propyl-2-pyridin-2-yl-4H-pyrazol-3-one is sourced from PubChem (CID 67581827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).