About 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate
2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate (PubChem CID 67582957) has the molecular formula C20H27BrN2O4
and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate |
| PubChem CID | 67582957 |
| Molecular Formula | C20H27BrN2O4 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate |
| SMILES | CCCC(=O)CC(=O)OCC.CCCC1=NN(c2ccc(Br)cc2)C(=O)C1 |
| InChI | InChI=1S/C12H13BrN2O.C8H14O3/c1-2-3-10-8-12(16)15(14-10)11-6-4-9(13)5-7-11;1-3-5-7(9)6-8(10)11-4-2/h4-7H,2-3,8H2,1H3;3-6H2,1-2H3 |
| InChIKey | IGKFUIZPODBESR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate?
The IUPAC name of 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate (CID 67582957) is 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate.
What is the SMILES notation for 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate?
The canonical SMILES for 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate is CCCC(=O)CC(=O)OCC.CCCC1=NN(c2ccc(Br)cc2)C(=O)C1.
What is the InChIKey of 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate?
The InChIKey is IGKFUIZPODBESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O.C8H14O3/c1-2-3-10-8-12(16)15(14-10)11-6-4-9(13)5-7-11;1-3-5-7(9)6-8(10)11-4-2/h4-7H,2-3,8H2,1H3;3-6H2,1-2H3.
What are the key properties of 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate?
2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate has a molecular weight of 439.35 g/mol, XLogP of 4.65, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-5-propyl-4H-pyrazol-3-one;ethyl 3-oxohexanoate is sourced from PubChem (CID 67582957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).