C19H27N3O4 — CID 67581829
ethyl 3-oxo-2-(3-oxo-5-propyl-2-pyridin-2-ylpyrazolidin-1-yl)hexanoate (PubChem CID 67581829) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 3-oxo-2-(3-oxo-5-propyl-2-pyridin-2-ylpyrazolidin-1-yl)hexanoate.
| Compound Name | ethyl 3-oxo-2-(3-oxo-5-propyl-2-pyridin-2-ylpyrazolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 67581829 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl 3-oxo-2-(3-oxo-5-propyl-2-pyridin-2-ylpyrazolidin-1-yl)hexanoate |
| SMILES | CCCC(=O)C(C(=O)OCC)N1C(CCC)CC(=O)N1c1ccccn1 |
| InChI | InChI=1S/C19H27N3O4/c1-4-9-14-13-17(24)22(16-11-7-8-12-20-16)21(14)18(15(23)10-5-2)19(25)26-6-3/h7-8,11-12,14,18H,4-6,9-10,13H2,1-3H3 |
| InChIKey | JHGLIMOXUDGLEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|