C15H20N2O6 — CID 67583120
(2R,3S)-2-amino-3-(4-carbamoylphenyl)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 67583120) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-(4-carbamoylphenyl)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3S)-2-amino-3-(4-carbamoylphenyl)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67583120 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2R,3S)-2-amino-3-(4-carbamoylphenyl)-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](c1ccc(C(N)=O)cc1)[C@@](N)(O)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c1-14(2,3)23-12(19)10(15(17,22)13(20)21)8-4-6-9(7-5-8)11(16)18/h4-7,10,22H,17H2,1-3H3,(H2,16,18)(H,20,21)/t10-,15-/m1/s1 |
| InChIKey | VILKRSWNOILWQS-MEBBXXQBSA-N |
| XLogP | -0.06 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|