C18H21NO6S2 — CID 67586390
2-(benzenesulfonamido)ethylsulfinyl 2-phenoxybutanoate (PubChem CID 67586390) has the molecular formula C18H21NO6S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-(benzenesulfonamido)ethylsulfinyl 2-phenoxybutanoate.
| Compound Name | 2-(benzenesulfonamido)ethylsulfinyl 2-phenoxybutanoate |
|---|---|
| PubChem CID | 67586390 |
| Molecular Formula | C18H21NO6S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-(benzenesulfonamido)ethylsulfinyl 2-phenoxybutanoate |
| SMILES | CCC(Oc1ccccc1)C(=O)OS(=O)CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO6S2/c1-2-17(24-15-9-5-3-6-10-15)18(20)25-26(21)14-13-19-27(22,23)16-11-7-4-8-12-16/h3-12,17,19H,2,13-14H2,1H3 |
| InChIKey | RMCJXYUDQFFCJA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |