C23H32O6 — CID 67586644
2-[1-[2-[2-[2-[1-(2-hydroxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethanol (PubChem CID 67586644) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[1-[2-[2-[2-[1-(2-hydroxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[1-[2-[2-[2-[1-(2-hydroxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 67586644 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[1-[2-[2-[2-[1-(2-hydroxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
| SMILES | CC(OCCO)Oc1ccccc1C(C)(C)c1ccccc1OC(C)OCCO |
| InChI | InChI=1S/C23H32O6/c1-17(26-15-13-24)28-21-11-7-5-9-19(21)23(3,4)20-10-6-8-12-22(20)29-18(2)27-16-14-25/h5-12,17-18,24-25H,13-16H2,1-4H3 |
| InChIKey | CLCFGLPORXMICA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|