C35H52O8 — CID 57197449
2-butoxy-3-[2-[2-[2-[3-butoxy-3-hydroxy-4-(oxiran-2-yl)butan-2-yl]oxyphenyl]propan-2-yl]phenoxy]-1-(oxiran-2-yl)butan-2-ol (PubChem CID 57197449) has the molecular formula C35H52O8 and a molecular weight of 600.79 g/mol. Its IUPAC name is 2-butoxy-3-[2-[2-[2-[3-butoxy-3-hydroxy-4-(oxiran-2-yl)butan-2-yl]oxyphenyl]propan-2-yl]phenoxy]-1-(oxiran-2-yl)butan-2-ol.
| Compound Name | 2-butoxy-3-[2-[2-[2-[3-butoxy-3-hydroxy-4-(oxiran-2-yl)butan-2-yl]oxyphenyl]propan-2-yl]phenoxy]-1-(oxiran-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 57197449 |
| Molecular Formula | C35H52O8 |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 2-butoxy-3-[2-[2-[2-[3-butoxy-3-hydroxy-4-(oxiran-2-yl)butan-2-yl]oxyphenyl]propan-2-yl]phenoxy]-1-(oxiran-2-yl)butan-2-ol |
| SMILES | CCCCOC(O)(CC1CO1)C(C)Oc1ccccc1C(C)(C)c1ccccc1OC(C)C(O)(CC1CO1)OCCCC |
| InChI | InChI=1S/C35H52O8/c1-7-9-19-40-34(36,21-27-23-38-27)25(3)42-31-17-13-11-15-29(31)33(5,6)30-16-12-14-18-32(30)43-26(4)35(37,22-28-24-39-28)41-20-10-8-2/h11-18,25-28,36-37H,7-10,19-24H2,1-6H3 |
| InChIKey | MXKHUPJTYPUJCD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|