About 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol
2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol (PubChem CID 174620010) has the molecular formula C10H20O7
and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol |
| PubChem CID | 174620010 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol |
| SMILES | C(OCC1CO1)C1CO1.CCCOC(O)(O)O |
| InChI | InChI=1S/C6H10O3.C4H10O4/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-8-4(5,6)7/h5-6H,1-4H2;5-7H,2-3H2,1H3 |
| InChIKey | PWKNFOGZHOOCFE-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol (CID 174620010) is 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol is C(OCC1CO1)C1CO1.CCCOC(O)(O)O.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol?
The InChIKey is PWKNFOGZHOOCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H10O4/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-8-4(5,6)7/h5-6H,1-4H2;5-7H,2-3H2,1H3.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol?
2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol has a molecular weight of 252.26 g/mol, XLogP of -1.20, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;propoxymethanetriol is sourced from PubChem (CID 174620010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).