About azido formate;1-methoxy-4-methylbenzene
azido formate;1-methoxy-4-methylbenzene (PubChem CID 67587053) has the molecular formula C9H11N3O3
and a molecular weight of 209.20 g/mol. Its IUPAC name is azido formate;1-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | azido formate;1-methoxy-4-methylbenzene |
| PubChem CID | 67587053 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | azido formate;1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C)cc1.[N-]=[N+]=NOC=O |
| InChI | InChI=1S/C8H10O.CHN3O2/c1-7-3-5-8(9-2)6-4-7;2-3-4-6-1-5/h3-6H,1-2H3;1H |
| InChIKey | MPXGNBGINWQTQJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azido formate;1-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido formate;1-methoxy-4-methylbenzene?
The IUPAC name of azido formate;1-methoxy-4-methylbenzene (CID 67587053) is azido formate;1-methoxy-4-methylbenzene.
What is the SMILES notation for azido formate;1-methoxy-4-methylbenzene?
The canonical SMILES for azido formate;1-methoxy-4-methylbenzene is COc1ccc(C)cc1.[N-]=[N+]=NOC=O.
What is the InChIKey of azido formate;1-methoxy-4-methylbenzene?
The InChIKey is MPXGNBGINWQTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.CHN3O2/c1-7-3-5-8(9-2)6-4-7;2-3-4-6-1-5/h3-6H,1-2H3;1H.
What are the key properties of azido formate;1-methoxy-4-methylbenzene?
azido formate;1-methoxy-4-methylbenzene has a molecular weight of 209.20 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azido formate;1-methoxy-4-methylbenzene is sourced from PubChem (CID 67587053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).