C20H22FN5O4S — CID 67588701
N-[2-(4-fluorophenyl)-4-methylsulfonylbutyl]-2-methoxy-5-(tetrazol-1-yl)benzamide (PubChem CID 67588701) has the molecular formula C20H22FN5O4S and a molecular weight of 447.49 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-4-methylsulfonylbutyl]-2-methoxy-5-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)-4-methylsulfonylbutyl]-2-methoxy-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 67588701 |
| Molecular Formula | C20H22FN5O4S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)-4-methylsulfonylbutyl]-2-methoxy-5-(tetrazol-1-yl)benzamide |
| SMILES | COc1ccc(-n2cnnn2)cc1C(=O)NCC(CCS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN5O4S/c1-30-19-8-7-17(26-13-23-24-25-26)11-18(19)20(27)22-12-15(9-10-31(2,28)29)14-3-5-16(21)6-4-14/h3-8,11,13,15H,9-10,12H2,1-2H3,(H,22,27) |
| InChIKey | ALORYVJWFYPCLM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |