C20H21N5O3 — CID 21311278
2-methoxy-N-methyl-N-[(2S)-4-oxo-2-phenylbutyl]-5-(tetrazol-1-yl)benzamide (PubChem CID 21311278) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-methoxy-N-methyl-N-[(2S)-4-oxo-2-phenylbutyl]-5-(tetrazol-1-yl)benzamide.
| Compound Name | 2-methoxy-N-methyl-N-[(2S)-4-oxo-2-phenylbutyl]-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 21311278 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-methoxy-N-methyl-N-[(2S)-4-oxo-2-phenylbutyl]-5-(tetrazol-1-yl)benzamide |
| SMILES | COc1ccc(-n2cnnn2)cc1C(=O)N(C)C[C@@H](CC=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N5O3/c1-24(13-16(10-11-26)15-6-4-3-5-7-15)20(27)18-12-17(8-9-19(18)28-2)25-14-21-22-23-25/h3-9,11-12,14,16H,10,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | CDPYSRCWXDFHBW-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|