C34H47NO4Si — CID 67591002
[(E)-4-trimethylsilylbut-2-enyl] 6-[1-[(Z)-hex-1-enyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl]oxypyridine-3-carboxylate (PubChem CID 67591002) has the molecular formula C34H47NO4Si and a molecular weight of 561.84 g/mol. Its IUPAC name is [(E)-4-trimethylsilylbut-2-enyl] 6-[1-[(Z)-hex-1-enyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl]oxypyridine-3-carboxylate.
| Compound Name | [(E)-4-trimethylsilylbut-2-enyl] 6-[1-[(Z)-hex-1-enyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl]oxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 67591002 |
| Molecular Formula | C34H47NO4Si |
| Molecular Weight | 561.84 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | [(E)-4-trimethylsilylbut-2-enyl] 6-[1-[(Z)-hex-1-enyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl]oxypyridine-3-carboxylate |
| SMILES | CCCC/C=C\c1c(C(=O)Oc2ccc(C(=O)OC/C=C/C[Si](C)(C)C)cn2)ccc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H47NO4Si/c1-9-10-11-12-15-26-27(17-18-28-30(26)34(4,5)21-20-33(28,2)3)32(37)39-29-19-16-25(24-35-29)31(36)38-22-13-14-23-40(6,7)8/h12-19,24H,9-11,20-23H2,1-8H3/b14-13+,15-12- |
| InChIKey | WHIHFJRDFHZMRR-RREJARNKSA-N |
| XLogP | 8.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.84 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|