C34H41NO4 — CID 10973423
benzyl 6-(3-hexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-3-carboxylate (PubChem CID 10973423) has the molecular formula C34H41NO4 and a molecular weight of 527.71 g/mol. Its IUPAC name is benzyl 6-(3-hexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-3-carboxylate.
| Compound Name | benzyl 6-(3-hexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 10973423 |
| Molecular Formula | C34H41NO4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | benzyl 6-(3-hexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-3-carboxylate |
| SMILES | CCCCCCc1cc2c(cc1C(=O)Oc1ccc(C(=O)OCc3ccccc3)cn1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H41NO4/c1-6-7-8-12-15-25-20-28-29(34(4,5)19-18-33(28,2)3)21-27(25)32(37)39-30-17-16-26(22-35-30)31(36)38-23-24-13-10-9-11-14-24/h9-11,13-14,16-17,20-22H,6-8,12,15,18-19,23H2,1-5H3 |
| InChIKey | KWBFIBGEHXUNAY-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|