C16H23NO2 — CID 67591447
1,4-dibutoxyindole (PubChem CID 67591447) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1,4-dibutoxyindole.
| Compound Name | 1,4-dibutoxyindole |
|---|---|
| PubChem CID | 67591447 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1,4-dibutoxyindole |
| SMILES | CCCCOc1cccc2c1ccn2OCCCC |
| InChI | InChI=1S/C16H23NO2/c1-3-5-12-18-16-9-7-8-15-14(16)10-11-17(15)19-13-6-4-2/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | ZKRLOULCEKZNKT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|