C25H30FN5O2 — CID 67594640
4-[2-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)imidazol-1-yl]cyclohexan-1-one (PubChem CID 67594640) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-[2-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)imidazol-1-yl]cyclohexan-1-one.
| Compound Name | 4-[2-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)imidazol-1-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 67594640 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[2-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)imidazol-1-yl]cyclohexan-1-one |
| SMILES | CC(C)(C)NCCOc1nccc(-c2nc(-c3ccc(F)cc3)cn2C2CCC(=O)CC2)n1 |
| InChI | InChI=1S/C25H30FN5O2/c1-25(2,3)28-14-15-33-24-27-13-12-21(30-24)23-29-22(17-4-6-18(26)7-5-17)16-31(23)19-8-10-20(32)11-9-19/h4-7,12-13,16,19,28H,8-11,14-15H2,1-3H3 |
| InChIKey | JJEBZDZZIPLBON-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|