C25H30FN5O2 — CID 69104023
4-[5-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]cyclohexan-1-one (PubChem CID 69104023) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-[5-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]cyclohexan-1-one.
| Compound Name | 4-[5-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 69104023 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[5-[2-[2-(tert-butylamino)ethoxy]pyrimidin-4-yl]-4-(4-fluorophenyl)-1H-imidazol-2-yl]cyclohexan-1-one |
| SMILES | CC(C)(C)NCCOc1nccc(-c2[nH]c(C3CCC(=O)CC3)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H30FN5O2/c1-25(2,3)28-14-15-33-24-27-13-12-20(29-24)22-21(16-4-8-18(26)9-5-16)30-23(31-22)17-6-10-19(32)11-7-17/h4-5,8-9,12-13,17,28H,6-7,10-11,14-15H2,1-3H3,(H,30,31) |
| InChIKey | VBMIQTKIVNMUMG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|