C16H17N3O3S — CID 67595359
3-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-N-phenylbenzenesulfonamide (PubChem CID 67595359) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-N-phenylbenzenesulfonamide.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67595359 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1cccc(OCC2=NCCN2)c1 |
| InChI | InChI=1S/C16H17N3O3S/c20-23(21,19-13-5-2-1-3-6-13)15-8-4-7-14(11-15)22-12-16-17-9-10-18-16/h1-8,11,19H,9-10,12H2,(H,17,18) |
| InChIKey | VTKSHLUFRILHOC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |