C21H32N4OS2 — CID 67595699
4-tert-butyl-N-[5-[1-[di(propan-2-yl)amino]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 67595699) has the molecular formula C21H32N4OS2 and a molecular weight of 420.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-[1-[di(propan-2-yl)amino]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[5-[1-[di(propan-2-yl)amino]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 67595699 |
| Molecular Formula | C21H32N4OS2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-tert-butyl-N-[5-[1-[di(propan-2-yl)amino]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(C)N(C(C)C)C(C)Sc1nnc(NC(=O)c2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C21H32N4OS2/c1-13(2)25(14(3)4)15(5)27-20-24-23-19(28-20)22-18(26)16-9-11-17(12-10-16)21(6,7)8/h9-15H,1-8H3,(H,22,23,26) |
| InChIKey | XKNGGKYRPXFOFO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|