C34H34N4O7S — CID 67595996
butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(4-nitrophenyl)sulfonylamino]phenoxy]piperidine-1-carboxylate (PubChem CID 67595996) has the molecular formula C34H34N4O7S and a molecular weight of 642.73 g/mol. Its IUPAC name is butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(4-nitrophenyl)sulfonylamino]phenoxy]piperidine-1-carboxylate.
| Compound Name | butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(4-nitrophenyl)sulfonylamino]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67595996 |
| Molecular Formula | C34H34N4O7S |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(4-nitrophenyl)sulfonylamino]phenoxy]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Oc2ccc(N(Cc3ccc4ccc(C#N)cc4c3)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)CC1 |
| InChI | InChI=1S/C34H34N4O7S/c1-2-3-20-44-34(39)36-18-16-32(17-19-36)45-31-12-8-29(9-13-31)37(46(42,43)33-14-10-30(11-15-33)38(40)41)24-26-5-7-27-6-4-25(23-35)21-28(27)22-26/h4-15,21-22,32H,2-3,16-20,24H2,1H3 |
| InChIKey | SMWAFEIQWJBEFK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 143.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|