C12H11NO8 — CID 67598008
2-(4-carboxy-3-methyl-2-nitrophenyl)-2-methylpropanedioic acid (PubChem CID 67598008) has the molecular formula C12H11NO8 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2-(4-carboxy-3-methyl-2-nitrophenyl)-2-methylpropanedioic acid.
| Compound Name | 2-(4-carboxy-3-methyl-2-nitrophenyl)-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 67598008 |
| Molecular Formula | C12H11NO8 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(4-carboxy-3-methyl-2-nitrophenyl)-2-methylpropanedioic acid |
| SMILES | Cc1c(C(=O)O)ccc(C(C)(C(=O)O)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11NO8/c1-5-6(9(14)15)3-4-7(8(5)13(20)21)12(2,10(16)17)11(18)19/h3-4H,1-2H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | JZXHRPPLEPEQOC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|