C17H23NO7 — CID 67598234
(Z)-but-2-enedioic acid;(1S)-2-[[(2R)-morpholin-2-yl]methoxy]-1-phenylethanol (PubChem CID 67598234) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(1S)-2-[[(2R)-morpholin-2-yl]methoxy]-1-phenylethanol.
| Compound Name | (Z)-but-2-enedioic acid;(1S)-2-[[(2R)-morpholin-2-yl]methoxy]-1-phenylethanol |
|---|---|
| PubChem CID | 67598234 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;(1S)-2-[[(2R)-morpholin-2-yl]methoxy]-1-phenylethanol |
| SMILES | O=C(O)/C=C\C(=O)O.O[C@H](COC[C@H]1CNCCO1)c1ccccc1 |
| InChI | InChI=1S/C13H19NO3.C4H4O4/c15-13(11-4-2-1-3-5-11)10-16-9-12-8-14-6-7-17-12;5-3(6)1-2-4(7)8/h1-5,12-15H,6-10H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t12-,13-;/m1./s1 |
| InChIKey | XCTOPEMYUVHSHE-HICQKLBZSA-N |
| XLogP | 0.44 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|