C16H19Cl2NO6 — CID 70455106
but-2-enedioic acid;2-[(2,6-dichlorophenyl)methoxymethyl]morpholine (PubChem CID 70455106) has the molecular formula C16H19Cl2NO6 and a molecular weight of 392.24 g/mol. Its IUPAC name is but-2-enedioic acid;2-[(2,6-dichlorophenyl)methoxymethyl]morpholine.
| Compound Name | but-2-enedioic acid;2-[(2,6-dichlorophenyl)methoxymethyl]morpholine |
|---|---|
| PubChem CID | 70455106 |
| Molecular Formula | C16H19Cl2NO6 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | but-2-enedioic acid;2-[(2,6-dichlorophenyl)methoxymethyl]morpholine |
| SMILES | Clc1cccc(Cl)c1COCC1CNCCO1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C12H15Cl2NO2.C4H4O4/c13-11-2-1-3-12(14)10(11)8-16-7-9-6-15-4-5-17-9;5-3(6)1-2-4(7)8/h1-3,9,15H,4-8H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | QOFFLKYIDMRSSV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|