C23H26ClNO7 — CID 68598997
(E)-but-2-enedioic acid;(2S)-2-[[3-(3-chlorophenyl)-2-methoxy-4-methylphenoxy]methyl]morpholine (PubChem CID 68598997) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-2-[[3-(3-chlorophenyl)-2-methoxy-4-methylphenoxy]methyl]morpholine.
| Compound Name | (E)-but-2-enedioic acid;(2S)-2-[[3-(3-chlorophenyl)-2-methoxy-4-methylphenoxy]methyl]morpholine |
|---|---|
| PubChem CID | 68598997 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-2-[[3-(3-chlorophenyl)-2-methoxy-4-methylphenoxy]methyl]morpholine |
| SMILES | COc1c(OC[C@@H]2CNCCO2)ccc(C)c1-c1cccc(Cl)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22ClNO3.C4H4O4/c1-13-6-7-17(24-12-16-11-21-8-9-23-16)19(22-2)18(13)14-4-3-5-15(20)10-14;5-3(6)1-2-4(7)8/h3-7,10,16,21H,8-9,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m0./s1 |
| InChIKey | CIYXFXCDBULLRH-SBWPJONASA-N |
| XLogP | 3.40 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|