C27H38N2O5S — CID 67599241
[4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonyl-2-methylphenyl] 2-[4-[butyl(methyl)amino]phenyl]butanoate (PubChem CID 67599241) has the molecular formula C27H38N2O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is [4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonyl-2-methylphenyl] 2-[4-[butyl(methyl)amino]phenyl]butanoate.
| Compound Name | [4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonyl-2-methylphenyl] 2-[4-[butyl(methyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 67599241 |
| Molecular Formula | C27H38N2O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonyl-2-methylphenyl] 2-[4-[butyl(methyl)amino]phenyl]butanoate |
| SMILES | CCCCN(C)c1ccc(C(CC)C(=O)Oc2ccc(S(=O)(=O)N3CCC[C@H]3CO)cc2C)cc1 |
| InChI | InChI=1S/C27H38N2O5S/c1-5-7-16-28(4)22-12-10-21(11-13-22)25(6-2)27(31)34-26-15-14-24(18-20(26)3)35(32,33)29-17-8-9-23(29)19-30/h10-15,18,23,25,30H,5-9,16-17,19H2,1-4H3/t23-,25?/m0/s1 |
| InChIKey | YHSKMUKKPRZRFN-LFQPHHBNSA-N |
| XLogP | 4.48 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|