C25H33N3O4S — CID 67604999
(2-methyl-4-piperazin-1-ylsulfonylphenyl) (2R)-2-(4-pyrrolidin-1-ylphenyl)butanoate (PubChem CID 67604999) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is (2-methyl-4-piperazin-1-ylsulfonylphenyl) (2R)-2-(4-pyrrolidin-1-ylphenyl)butanoate.
| Compound Name | (2-methyl-4-piperazin-1-ylsulfonylphenyl) (2R)-2-(4-pyrrolidin-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 67604999 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2-methyl-4-piperazin-1-ylsulfonylphenyl) (2R)-2-(4-pyrrolidin-1-ylphenyl)butanoate |
| SMILES | CC[C@@H](C(=O)Oc1ccc(S(=O)(=O)N2CCNCC2)cc1C)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O4S/c1-3-23(20-6-8-21(9-7-20)27-14-4-5-15-27)25(29)32-24-11-10-22(18-19(24)2)33(30,31)28-16-12-26-13-17-28/h6-11,18,23,26H,3-5,12-17H2,1-2H3/t23-/m1/s1 |
| InChIKey | COKFOXCSCHADDX-HSZRJFAPSA-N |
| XLogP | 3.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|