C28H39N3O4S — CID 67595344
[2-methyl-4-(2-piperidin-1-ylethylsulfamoyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate (PubChem CID 67595344) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is [2-methyl-4-(2-piperidin-1-ylethylsulfamoyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate.
| Compound Name | [2-methyl-4-(2-piperidin-1-ylethylsulfamoyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 67595344 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | [2-methyl-4-(2-piperidin-1-ylethylsulfamoyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
| SMILES | CCC(C(=O)Oc1ccc(S(=O)(=O)NCCN2CCCCC2)cc1C)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C28H39N3O4S/c1-3-26(23-9-11-24(12-10-23)31-18-7-8-19-31)28(32)35-27-14-13-25(21-22(27)2)36(33,34)29-15-20-30-16-5-4-6-17-30/h9-14,21,26,29H,3-8,15-20H2,1-2H3 |
| InChIKey | MGAOYMQFKPNROP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|