C28H36N2O4S — CID 67597718
[4-(3-azabicyclo[3.2.2]nonan-3-ylsulfonyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate (PubChem CID 67597718) has the molecular formula C28H36N2O4S and a molecular weight of 496.67 g/mol. Its IUPAC name is [4-(3-azabicyclo[3.2.2]nonan-3-ylsulfonyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate.
| Compound Name | [4-(3-azabicyclo[3.2.2]nonan-3-ylsulfonyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
|---|---|
| PubChem CID | 67597718 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [4-(3-azabicyclo[3.2.2]nonan-3-ylsulfonyl)phenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
| SMILES | CCC(C(=O)Oc1ccc(S(=O)(=O)N2CC3CCC(CC3)C2)cc1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C28H36N2O4S/c1-2-27(23-9-11-24(12-10-23)29-17-3-4-18-29)28(31)34-25-13-15-26(16-14-25)35(32,33)30-19-21-5-6-22(20-30)8-7-21/h9-16,21-22,27H,2-8,17-20H2,1H3 |
| InChIKey | CEALBFNVEVZGRD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|