C30H38N2O5S — CID 67601235
(2S)-1-[4-[3-(4-pyrrolidin-1-ylphenyl)pent-1-en-2-yloxy]phenyl]sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 67601235) has the molecular formula C30H38N2O5S and a molecular weight of 538.71 g/mol. Its IUPAC name is (2S)-1-[4-[3-(4-pyrrolidin-1-ylphenyl)pent-1-en-2-yloxy]phenyl]sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[3-(4-pyrrolidin-1-ylphenyl)pent-1-en-2-yloxy]phenyl]sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 67601235 |
| Molecular Formula | C30H38N2O5S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (2S)-1-[4-[3-(4-pyrrolidin-1-ylphenyl)pent-1-en-2-yloxy]phenyl]sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | C=C(Oc1ccc(S(=O)(=O)N2C3CCCCC3C[C@H]2C(=O)O)cc1)C(CC)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C30H38N2O5S/c1-3-27(22-10-12-24(13-11-22)31-18-6-7-19-31)21(2)37-25-14-16-26(17-15-25)38(35,36)32-28-9-5-4-8-23(28)20-29(32)30(33)34/h10-17,23,27-29H,2-9,18-20H2,1H3,(H,33,34)/t23?,27?,28?,29-/m0/s1 |
| InChIKey | YCUFLQBNDOFUSB-HYDSKGGASA-N |
| XLogP | 5.78 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|