C21H17N3O3 — CID 67599345
2-[4-(4-imidazol-1-ylphenoxy)but-2-enyl]isoindole-1,3-dione (PubChem CID 67599345) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[4-(4-imidazol-1-ylphenoxy)but-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-imidazol-1-ylphenoxy)but-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67599345 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[4-(4-imidazol-1-ylphenoxy)but-2-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC=CCOc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C21H17N3O3/c25-20-18-5-1-2-6-19(18)21(26)24(20)12-3-4-14-27-17-9-7-16(8-10-17)23-13-11-22-15-23/h1-11,13,15H,12,14H2 |
| InChIKey | QDSNFXJSJJBGNC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|